1-hydroxy-4-unsubstituted benzenoids
![eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Combi-Blocks | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 117541572](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000159536.jpg-250.jpg)
eMolecules 5470-17-7 | 3-Bromo-2-chloro-5-nitropyridine | Combi-Blocks | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 117541572
3-Bromo-2-chloro-5-nitropyridine | Combi-Blocks | 5470-17-7 | MFCD00233989 | 237.440 | C5H2BrClN2O2 | 98.000 | [O-][N+](=O)c1cnc(Cl)c(Br)c1 | 100g | 117541572
Sigma Aldrich Fine Chemicals Biosciences (R)-(-)-Phenylephrine hydrochloride powder | 61-76-7 | MFCD00012605 | 100G
(R)-(-)-Phenylephrine hydrochloride powder | Mol Wt: 203.67 | 61-76-7 | MFCD00012605 | 100G
Accela Chembio Inc 3-cyanophenol | 25g | 873-62-1 | MFCD00002252 | 98% | Shelf Life: 1620 Days | Light Sensitive
3-cyanophenol | 25g | 873-62-1 | MFCD00002252 | 98% | Shelf Life: 1620 Days | Light Sensitive
Ambeed 2-Hydroxyphenylboronic acid | 89466-08-0 | 137.93 g/mol | 10G
2-Hydroxyphenylboronic acid | 89466-08-0 | 137.93 g/mol | 10G
Selleck Chemical LLC 4-Ethylphenol
4-Ethylphenol (P-Ethylphenol 4-Hydroxyphenylethane) is a phenolic compound produced in wine and beer by the spoilage yeast Brettanomyces
Selleck Chemical LLC 3 5-Dimethoxyphenol
3 5-Dimethoxyphenol (Phloroglucinol dimethyl ether) is a toxin metabolite that can be found in human consuming yew (Taxus baccata) leaves
eMolecules 1-(2-Fluoro-5-hydroxyphenyl)ethanone | Combi-Blocks | 145300-04-5 | MFCD09038472 | 154.140 | C8H7FO2 | 97.000 | CC(=O)c1cc(O)ccc1F | 10g | 374522362
1-(2-Fluoro-5-hydroxyphenyl)ethanone | Combi-Blocks | 145300-04-5 | MFCD09038472 | 154.140 | C8H7FO2 | 97.000 | CC(=O)c1cc(O)ccc1F | 10g | 374522362